All Stories

  1. Synthesis, structural studies and Hirshfeld surface analysis of 2-[(4-phenyl-1H-1,2,3-triazol-1-yl)methyl]pyridin-1-ium hexakis(nitrato-κ2 O,O′)thorate(IV)
  2. A cyclodiphosphazane based pincer ligand, [2,6-{μ-(tBuN)2P(tBuHN)PO}2C6H3I]: NiII, PdII, PtII and CuI complexes and catalytic studies
  3. A phosphomide based PNP ligand, 2,6-{Ph2PC(O)}2(C5H3N), showing PP, PNP and PNO coordination modes
  4. Gold(i) complexes of bisphosphines with bis(azol-1-yl)methane backbone: structure of a rare dinuclear gold(i) complex [(Au2Cl){CH2(1,2-C3H2N2PPh2)2}...
  5. Chalcogenide derivatives of 1,2,5-triphenyl-1H-phosphole: structure and photophysical properties
  6. Short-Bite PNP Ligand-Supported Rare Tetranuclear [Cu4I4] Clusters: Structural and Photoluminescence Studies
  7. phosphines, metals and catalysis
  8. Quaternization and oxidation reactions of cyclodiphosphazane derivatives and their copper(i) and gold(i) complexes
  9. Iron-catalyzed aerobic oxidative aromatization of 1,3,5-trisubstituted pyrazolines
  10. Novel zeotype frameworks with soft cyclodiphosphazane linkers and soft Cu4X4 clusters as nodes
  11. Copper and palladium complexes of 2-(diphenylphosphino)-N,N-dimethylbenzylamine and its selenide derivative
  12. N1,N1,N4,N4-Tetrakis(dibenzylphosphino)benzene-1,4-diamine: Synthesis, structural studies and transition metal chemistry
  13. Synthesis, transition metal chemistry and catalytic reactions of ferrocenylbis(phosphonite), [Fe{C5H4P(OC6H3(OMe-o)(C3H5-p))2}2]
  14. Simple tertiary phosphines to hexaphosphane ligands: Syntheses, transition metal chemistry and their catalytic applications
  15. Allyl functionalized phosphinite and phosphonite ligands: Synthesis, transition metal chemistry and orthopalladation reactions
  16. ChemInform Abstract: Cyclodiphosphazanes with Functionalities: Synthesis, Reactivity and Transition Metal Chemistry.
  17. Cyclodiphosphazanes with functionalities: Synthesis, reactivity and transition metal chemistry
  18. Transition metal chemistry of cyclodiphosphanes containing phosphine and amide-phosphine functionalities: Formation of a stable dipalladium(II) complex containing a Pd–P σ-bond.
  19. Silver(I) complexes of bis[2-(diphenylphosphino)phenyl] ether
  20. Highly Air-Stable Anionic Mononuclear and Neutral Binuclear Palladium(II) Complexes for C−C and C−N Bond-Forming Reactions
  21. Methylene insertion into the exocyclic P–N bonds of bis(amido)cyclodiphosphazane, cis-[tBu(H)NP(μ-tBuN)]2
  22. Chemistry of Pnictogen(III)—Nitrogen Ring Systems
  23. Group 11 Metal Complexes of the Mesocyclic Thioether Aminophosphonites [‐OC10H6(μ‐S)C10H6O‐]PNC4H8E (E = O, NMe)
  24. One-dimensional silver(i) coordination polymers containing cyclodiphosphazane, cis-{(o-MeOC6H4O)P(µ-NtBu)}2
  25. Intramolecular Amine-Induced [1,3]-Sigmatropic Rearrangement in the Reactions of Aminophosphinites or Phosphites with Elemental Sulfur or Selenium
  26. First Example of a Heptacyclic Tetranuclear, Five- and Six-coordinate Titanium Complex, [{(iPrO)2Ti(μ3-O)TiCl(iPrO)((OC6H4)2PPh)}2]